On Target V1AR_HUMAN 0.38536584/CHEMBL330510
For the given ligand chenyan1, we have found in our database that, being scored 0.38536584, the most similar ligand is CHEMBL330510. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL330510 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CN1CCN(CCCCCCOc2cccc(c2)n3c(C)nnc3c4ccc(cc4)c5ccccc5)CC1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0400e002 81000008 e0100108 04010700 01081040 06000004 22800000 20081040 00000100 000008c0 10208104 40018808 02800802 08802201 11060041 000c200c 08828000 02002004 04402000 10260601 40100000 3800a010 31800021 0250c010 00000000 c0000040 10000000 10001060 08014204 00261000 80040a80 00200202 |