On Target OPRK_HUMAN 0.3794872/CHEMBL480425
For the given ligand chenyan1, we have found in our database that, being scored 0.3794872, the most similar ligand is CHEMBL480425. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL480425 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CC1(CCCCCCC1)N2CCC(CC2)n3c(nc4ccccc34)c5cccc(OCCO)c5 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04004002 41000408 20100108 10810600 200c1060 00006000 02000000 20080000 00200100 100019c0 0120800c 50018000 00801002 01c40080 012200c1 020c000c 00100080 02002000 00682000 00422201 c0100000 38000030 a5800001 08500010 00000000 c0000000 00000004 10800000 00000204 00460c10 400a0800 00002280 |