On Target NPY4R_HUMAN 0.30136988/CHEMBL2371909
For the given ligand chenyan1, we have found in our database that, being scored 0.30136988, the most similar ligand is CHEMBL2371909. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL2371909 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CC[C@H](N)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc5ccc(O)cc5)C(=O)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc6ccc(O)cc6)C(=O)N |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 00010002 01003a08 20100100 45810e10 00041202 00000000 02012000 2000000c 00600880 000908c2 08300014 4003b000 1e00881a 00402809 80000040 0004000c 00000800 02000000 00202408 00020201 40000100 38248638 20800003 93500018 00043800 80000000 48130000 10000000 0c000000 0006000b 20044200 00002620 |