On Target PTAFR_HUMAN 0.43842363/CHEMBL37602
For the given ligand chenyan1, we have found in our database that, being scored 0.43842363, the most similar ligand is CHEMBL37602. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL37602 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COc1ccc(cc1OC)C2CCC(OCc3ccc(cc3)n4c(C)nc5ccccc45)O2 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 00000002 4b800a08 2000010a 10090700 082c1070 40004000 02048800 08001000 00300900 000818e8 0d10800c 40018000 80005802 20610200 010e0045 022c900c 08800008 02000000 10688000 00020201 c0000120 18008030 21800041 81400010 00000400 c0002040 005a8000 24000000 04000204 0046080a 40040000 02000480 |