On Target 5HT1F_HUMAN 0.33668342/CHEMBL497963
For the given ligand chenyan1, we have found in our database that, being scored 0.33668342, the most similar ligand is CHEMBL497963. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL497963 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Cc1ccc2c(OCCN3CCC(Cc4cccc(NS(=O)(=O)C)c4)CC3)cccc2n1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04002002 01000008 2010410a 10310602 000410a0 00000000 06000000 20000008 00500800 000808c0 08302004 50018000 00800c02 00600801 810a1041 020e000c 10000000 02000004 00200000 00064201 40000100 18048808 32800000 80500010 00040080 80000000 00000040 1000000d 00400206 00060002 00040000 00250660 |