On Target CLTR1_HUMAN 0.41784036/CHEMBL1214532
For the given ligand chenyan1, we have found in our database that, being scored 0.41784036, the most similar ligand is CHEMBL1214532. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL1214532 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COc1ccc(NS(=O)(=O)C(F)(F)F)cc1C[C@H]2[C@@H](CO)c3cc(\C=C\c4ccc5ccc(C)cc5n4)ccc3OC2(C)C |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04000002 01000818 2010411a 10310f00 002c1061 82000000 82040080 08008608 00400800 00080840 08102104 40008140 81800c02 00608801 910e1043 020e280c 08000400 22008000 10600000 00024001 40000100 18008808 21800041 81410410 00040080 c2000001 00462048 c000020c 00404306 00274002 04040000 00010660 |