On Target ADRB1_HUMAN 0.4589372/CHEMBL467298
For the given ligand chenyan1, we have found in our database that, being scored 0.4589372, the most similar ligand is CHEMBL467298. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL467298 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | O[C@@H](CNCCc1ccc(NC(=O)Cc2nc3ccccc3n2Cc4ccccc4)cc1)COc5ccccc5 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0400400a 00800a08 20100528 50010600 200c10e0 02004000 02000000 00001000 80100180 10081ac0 0928800c 40819000 02809802 00508000 812a00c1 020c200c 10240000 0a000000 08e82000 00030200 c0100000 18208630 278020c1 8b400410 00001001 c0000080 10000000 00800080 04008204 0046080b 400c5000 200026c0 |