On Target 5HT1E_HUMAN 0.33695653/CHEMBL267615
For the given ligand chenyan1, we have found in our database that, being scored 0.33695653, the most similar ligand is CHEMBL267615. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL267615 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CCc1[nH]c2ccc(OC)cc2c1CCN(C)C |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0000000a 00004808 20100108 51010610 00041020 00000000 060c2000 00000001 00400000 00090840 08208004 40808000 10000806 00608000 01020041 0204000c 00000200 02000004 00200400 00020200 40000000 18208008 20804000 91400010 00042000 80000000 08120000 00000000 04000204 00060002 00040200 20000620 |