On Target GRM1_HUMAN 0.39148936/CHEMBL3968177
For the given ligand chenyan1, we have found in our database that, being scored 0.39148936, the most similar ligand is CHEMBL3968177. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL3968177 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COc1ccc(cc1)N2C(=Nc3c(csc3C2=O)c4ccccc4)C |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 00032012 21000208 20000918 10010610 001c1060 00004808 4a009802 00001088 26100100 400008f0 01104a0c 40038080 0001980a 00600201 090610c1 820c000c 28020008 22008084 0c600000 40830002 40000080 580480b0 318040c1 81700000 00844001 c4180048 20048200 00040044 04414a04 00461048 4004a024 41c10e80 |