On Target CXCR1_HUMAN 0.27192983/CHEMBL3609013
For the given ligand chenyan1, we have found in our database that, being scored 0.27192983, the most similar ligand is CHEMBL3609013. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL3609013 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | OB(O)c1ccc(CN(Cc2ccccc2)c3ccc(cn3)C(=O)Nc4ccc(F)cc4)nc1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 10004002 00a08800 00104182 92010e18 01061820 00100010 00004000 02003001 00000180 20000848 01298004 6000c000 40008802 04109000 00020d40 021c0104 00042000 03004006 08200000 00a00200 c0100000 0c048e00 21812800 0060000c 00160000 c0000081 0c0000c0 90000081 0060811c 00068801 80041000 80004220 |