On Target GRM2_HUMAN 0.41666666/CHEMBL594236
For the given ligand chenyan1, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL594236. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL594236 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Clc1cnc(nc1)N2CCN(Cc3nc4ccccc4n3Cc5ccccc5)CC2 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 00040002 00800200 00100900 14010e00 000c0060 00104000 02002000 00003001 80100100 200018c0 0121800c 40018800 04001802 00402000 000200c0 021c0104 00000008 02004002 00680008 00a20000 c0000001 3e038130 21800861 83400000 00111000 c0000000 00000000 00000000 0c00001c 00460808 400c1000 00024680 |