On Target OPRD_HUMAN 0.3974359/CHEMBL561138
For the given ligand chenyan1, we have found in our database that, being scored 0.3974359, the most similar ligand is CHEMBL561138. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL561138 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CCN(CC)C(=O)c1ccc(nc1)C2=CC3(CCNCC3)Oc4ccccc24 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 1400000a 01808828 20104308 50010610 00241020 82180000 82004080 2b001608 14000104 001808d0 49208004 50818800 8e828882 00000000 01021483 020c208c 00224400 2a008005 10a0001c 20020201 c1040000 18148e00 218080a0 0241011c 01041001 e2000000 08402040 d0008680 04400384 80060003 86000000 a0000650 |