On Target CXCR4_HUMAN 0.36697248/CHEMBL583443
For the given ligand chenyan1, we have found in our database that, being scored 0.36697248, the most similar ligand is CHEMBL583443. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL583443 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CN(Cc1nc2cccc(CN3CCNCC3)c2[nH]1)C4CCCc5cccnc45 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 1000000a 01004800 00104902 14850e10 00041160 00104000 01006000 22003003 00500900 000908d0 49318004 40818000 00000882 0860a800 00020440 020c0104 00020208 06000006 00202408 40000201 40120100 38018820 21804020 02500110 00144000 c0000001 08004040 90000080 08400106 00c60802 40048000 a00046a0 |