On Target CNR2_HUMAN 0.4642857/CHEMBL471992
For the given ligand chenyan1, we have found in our database that, being scored 0.4642857, the most similar ligand is CHEMBL471992. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL471992 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CCOc1ccc(Cc2nc3cc(ccc3n2Cc4ccccc4)C(=O)N(CC)CC)cc1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0400000a 00809a08 20100508 10050600 000c1060 00084000 02040000 02001004 80100100 100818c0 0920800c 40818000 00809802 00408000 010204c1 020c008c 00000008 02000005 00680000 00030000 c0000000 18068630 21800041 8140041c 00004000 c0000000 00120040 80000000 04400304 0046084b e00c8000 200006a0 |