On Target GRM8_HUMAN 0.39423078/CHEMBL3560922
For the given ligand chenyan1, we have found in our database that, being scored 0.39423078, the most similar ligand is CHEMBL3560922. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL3560922 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)COc3ccc(OC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0400100a 00801a08 20080108 d0090610 00005060 0200c000 02002000 00001044 00500100 000838d0 00040004 4001c000 80808802 00218200 010b00c1 0a0c200c 18020000 82800004 04200500 00020000 c4000000 18068a20 31804000 8140001c 00042000 c0002040 08080008 00001804 04000204 1006084a c0040200 12000020 |