On Target BKRB2_HUMAN 0.44680852/CHEMBL544623
For the given ligand chenyan1, we have found in our database that, being scored 0.44680852, the most similar ligand is CHEMBL544623. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL544623 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Cl.Cl.Cl.Cc1ccc2cccc(OCc3c(\C=C\c4ccncc4)ccc(c3\C=C\c5ccncc5)n6cccc6CNC(=O)\C=C\c7ccc(\C=C\c8ccncc8)nc7)c2n1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04080002 01808a08 60004108 12010e10 00041025 04104004 92900080 0a223409 01900100 004028d0 01250904 40058800 80808802 08610200 81020443 024c010c 24000400 02000106 18238000 80820803 c1120001 1a118628 20a00000 81c19108 00140400 c2082041 08482241 c0010200 04404305 00260049 64040200 80126222 |