On Target 5HT4R_HUMAN 0.3707317/CHEMBL2402898
For the given ligand chenyan1, we have found in our database that, being scored 0.3707317, the most similar ligand is CHEMBL2402898. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL2402898 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COC(=O)N1CCN(CCN2CCC(CNC(=O)c3cccc4[nH]c(nc34)C(C)C)CC2)CC1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 1000000a 01003800 00100500 14050610 00040060 00014000 00004000 2200100c 00a00300 000008d0 41208004 50838000 00008882 0040a000 000204c0 021e000c 00020008 02000000 00200000 40000201 c0000000 38068e30 21800023 0250011c 00044000 c0000002 00000040 90000020 08000304 00460801 e0048000 a00002a0 |