On Target MC5R_HUMAN 0.33877552/CHEMBL503229
For the given ligand chenyan1, we have found in our database that, being scored 0.33877552, the most similar ligand is CHEMBL503229. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL503229 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CCCC[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C)C(C)C)C(=O)NCC(=O)N[C@@H](Cc2cnc[nH]2)C(=O)N[C@H](Cc3ccccc3)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc4c[nH]c5ccccc45)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc6ccccc6)C(=O)NCC(=O)N |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04070002 01003a08 20100100 45810e10 04141240 00000000 02002020 2000200c 00600b80 00090ac2 28308004 5003b800 1e00981a 00502801 81020040 001c000c 00000000 0e000001 00e02418 40020201 60000d00 38358e38 21800083 93500018 00043801 80000200 48120000 10000100 0c000016 0046000b e00c4200 20802e20 |