On Target V1AR_HUMAN 0.3647059/CHEMBL1085123
For the given ligand a, we have found in our database that, being scored 0.3647059, the most similar ligand is CHEMBL1085123. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1085123 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CC1(C)C[C@@H]2C[C@@](C)(CN2C(=O)c3ccc(cc3Cl)c4cccc5ccccc45)C1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 01001800 00100100 40810600 00000000 00000010 04000000 22001000 00000100 000008c0 00200000 40018800 82008806 00000000 80000400 00000000 00020000 03000000 06002000 90002201 00000800 18068718 10000000 0050001c 00002000 c0000200 00000000 90000140 00004100 00060001 a8060000 00022200 |