On Target NPY2R_HUMAN 0.21481481/CHEMBL1398754
For the given ligand a, we have found in our database that, being scored 0.21481481, the most similar ligand is CHEMBL1398754. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1398754 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Cc1ccc(C)c(NS(=O)(=O)c2cc(ccc2Cl)C(=O)Nc3ccccc3c4ccccc4)c1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000e012 00800801 01004902 00b10600 00000120 00010040 00000000 02081000 01000100 00084840 00282104 6000c800 02048c46 80100001 802a10c0 00020100 04062000 02002000 0c410000 00006200 c0100000 18028f00 30052040 0844000c 00042080 80090000 00040010 800010cc 0040c502 21060001 80040800 40030260 |