On Target AA2BR_HUMAN 0.26605505/CHEMBL2024112
For the given ligand a, we have found in our database that, being scored 0.26605505, the most similar ligand is CHEMBL2024112. Check out the elaboration below.
| a (Given Ligand) | CHEMBL2024112 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Nc1nnc(c2cc(Cl)cc(Cl)c2)c(n1)c3ccccc3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008003 40000009 e0001180 01010210 01004040 0000802c 44800000 00080a00 00000100 11000840 00000080 40008800 02000004 00200401 a0030000 800c600c 000288c0 02802000 04000000 40247000 00000020 08001100 21000840 00404000 00042401 80080000 10000200 00000060 0001400c 00061001 40000a80 102a0000 |