On Target CCR4_HUMAN 0.21100917/CHEMBL233047
For the given ligand a, we have found in our database that, being scored 0.21100917, the most similar ligand is CHEMBL233047. Check out the elaboration below.
| a (Given Ligand) | CHEMBL233047 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | N.CCN(CC)C(C)CCCNc1nccc(NCc2ccc(Cl)cc2Cl)n1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00018002 01000001 00100100 08090600 02000008 00004020 0000a000 22101880 00200100 200008c0 00200004 4003d800 06000846 00000400 03000000 000c0004 00040000 02004000 00400000 00a00201 00100800 1c048100 20814840 00500010 00002000 80000280 00040000 900000c0 00000108 00460800 48041000 000202c0 |