On Target GASR_HUMAN 0.22772278/CHEMBL537171
For the given ligand a, we have found in our database that, being scored 0.22772278, the most similar ligand is CHEMBL537171. Check out the elaboration below.
| a (Given Ligand) | CHEMBL537171 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Cl.CN1CCN(CC1)C(=O)CCC(NC(=O)c2cc(Cl)cc(Cl)c2)C(=O)N3CCC4(CCCCC4)CC3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00038000 09003800 00100100 04010600 00000000 00000020 04000000 22001008 00200000 000308c8 00200000 5003b800 06008816 00002400 80000400 00000000 00000000 02000000 02002000 00000201 00000000 38068730 00000021 0250001c 00002000 c0000000 00000000 90000000 08000100 00060801 a0064000 00822200 |