On Target HRH2_HUMAN 0.2647059/CHEMBL2207642
For the given ligand a, we have found in our database that, being scored 0.2647059, the most similar ligand is CHEMBL2207642. Check out the elaboration below.
| a (Given Ligand) | CHEMBL2207642 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | COc1ccccc1N2CCN(Cc3cc(CN4CCN(CC4)c5ccc(Cl)cc5)c6cccccc36)CC2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000e002 00000009 20000128 14010680 80001000 00000000 12000000 02001000 00000100 10010a40 00200004 40008800 82000806 00202000 21000441 00004008 00060000 02000000 0c000800 10620000 40120000 2c008108 30001020 02408002 00002000 c0000000 28084000 800000c0 0800c300 00060000 00040800 02020200 |