On Target CCR5_HUMAN 0.24418604/CHEMBL94032
For the given ligand a, we have found in our database that, being scored 0.24418604, the most similar ligand is CHEMBL94032. Check out the elaboration below.
| a (Given Ligand) | CHEMBL94032 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1cccc(c1)[C@H]2CN(Cc3ccccc3)C[C@@H]2CN4CCC(CC4)c5ccccc5 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 05000600 00100100 00010600 00000000 00000010 04000000 22001000 00200880 000809e0 08300000 50038800 02000806 00000000 80000400 00040000 00000000 02000000 00000000 00000201 00000100 18208100 00000000 815c0010 00002000 c0000000 00000000 90000000 04000100 0006001a 20040000 00022600 |