On Target MC4R_HUMAN 0.2929293/CHEMBL226177
For the given ligand a, we have found in our database that, being scored 0.2929293, the most similar ligand is CHEMBL226177. Check out the elaboration below.
| a (Given Ligand) | CHEMBL226177 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CC(C)N1CCN(CC1)C(CN2CCN(CCCc3c(Cl)cccc3c4ccccc4)CC2)c5ccc(F)cc5 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 00000201 00100100 06810600 00020000 00000010 04000000 22001000 00000880 000908c0 08300000 40008880 02000806 00203000 a0000400 02040001 00020000 02000180 04000000 00102201 00000500 38208100 10004023 83400010 00802000 c0000201 00000000 90000041 0c004100 0006800a 00040000 00020600 |