On Target ADRB3_HUMAN 0.40789473/CHEMBL269823
For the given ligand a, we have found in our database that, being scored 0.40789473, the most similar ligand is CHEMBL269823. Check out the elaboration below.
| a (Given Ligand) | CHEMBL269823 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | O[C@@H](CNCCc1ccc(cc1)c2ccc(C(=O)O)c(Cl)c2)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 14000800 00100100 40850600 00000080 00004000 04000000 00000000 00000180 00080840 08200000 40008800 02008006 00000000 80080000 00080008 10020000 03000000 04000000 10002200 00001000 18220b20 12000000 81480014 00002000 80000200 00000000 00000040 04004000 00060002 c0000000 00022600 |