On Target ACM4_HUMAN 0.23595506/CHEMBL809
For the given ligand a, we have found in our database that, being scored 0.23595506, the most similar ligand is CHEMBL809. Check out the elaboration below.
| a (Given Ligand) | CHEMBL809 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c3ccccc13 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008008 05000000 00100102 10010600 00000000 00000002 04000400 03001001 00100800 000808c4 08300000 40018800 020008a4 00200000 80000000 00000080 00000200 02000000 00102000 00000001 00020100 18008100 00004000 00540010 00002000 a0100001 00040000 d0000000 02000182 00860002 00040000 00020600 |