On Target MC3R_HUMAN 0.2/CHEMBL185862
For the given ligand a, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL185862. Check out the elaboration below.
| a (Given Ligand) | CHEMBL185862 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | NCCC(=O)N[C@H](Cc1ccc(Cl)cc1Cl)C(=O)N2CCN(CC2)C3(CNC(=O)Cc4ccccc4)CCCCC3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 01003600 00110100 04010600 00000000 00000020 00000000 2000000c 00000880 000809c0 08300000 4001b980 0f00a026 00002400 c0000000 00040001 00000000 02000000 02002008 00000201 00000500 38240710 00000023 83500018 00002800 80000200 00040000 10000000 0c000000 0006001b 20026000 00022600 |