On Target NK1R_HUMAN 0.35714287/CHEMBL92032
For the given ligand a, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL92032. Check out the elaboration below.
| a (Given Ligand) | CHEMBL92032 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | N[C@H](COCc1cc(Cl)cc(Cl)c1)c2ccccc2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 10000000 00000100 80010600 00000050 00004020 04000000 00001040 00000100 00080840 08001000 40008800 02000804 00010400 80041000 02080008 08000000 02000000 04000000 00000000 00010020 08008120 03000000 00400010 00002400 80002000 00080000 00000000 00800200 00060002 40040000 02020400 |