On Target OPRK_HUMAN 0.2837838/CHEMBL102999
For the given ligand a, we have found in our database that, being scored 0.2837838, the most similar ligand is CHEMBL102999. Check out the elaboration below.
| a (Given Ligand) | CHEMBL102999 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CN(CCc1ccc(Cl)c(Cl)c1)[C@@H]2CCCC[C@H]2N3CCCC3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 05000000 00100100 04010600 00000000 00000010 04000000 20000000 00000080 000808c0 08200000 40018800 02000026 00002000 80000000 00000000 00000000 02000000 02002000 00000201 00000000 38200110 00000001 83580010 00002000 80100000 00040000 10000000 0c000000 00060002 00000000 00022600 |