On Target ACM1_HUMAN 0.375/CHEMBL1084850
For the given ligand a, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL1084850. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1084850 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | OC(CCC1CCNCC1)c2ccccc2c3cccc(Cl)c3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 01000001 00100102 00810600 000a0000 00004000 04000000 20000000 00000900 000808c0 08300000 50018800 02000006 00a00000 a0000020 00080008 00020080 02000000 04402000 00002201 00000100 18000130 11004000 00500010 00802000 80000001 00000000 10000040 00004002 00060002 40020000 00020600 |