On Target CNR1_HUMAN 0.57894737/CHEMBL3950898
For the given ligand a, we have found in our database that, being scored 0.57894737, the most similar ligand is CHEMBL3950898. Check out the elaboration below.
| a (Given Ligand) | CHEMBL3950898 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CC(C)(c1ccccc1)c2ccc(c(O)c2)c3cc(Cl)cc(Cl)c3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 42000008 20000100 00810200 00000000 00000020 06000000 01000000 00000100 00080840 08000000 40008800 02000006 00000400 80000000 00002008 00020200 02000000 04000000 10022200 00000000 08000100 10000000 00424010 00002000 a0000000 10000000 40000040 00004080 00020002 00000200 00020400 |