On Target PTAFR_HUMAN 0.2038835/CHEMBL416120
For the given ligand a, we have found in our database that, being scored 0.2038835, the most similar ligand is CHEMBL416120. Check out the elaboration below.
| a (Given Ligand) | CHEMBL416120 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | O=C(NCCCCc1cccnc1)c2ccc(cc2)c3ccccc3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00002002 01005800 00104102 40810610 00041100 00000000 00002000 22001000 00500900 000808c0 00300004 40018000 80008802 00200800 00000400 00040004 00020000 02000004 04200400 10000201 40000100 18068600 30800000 0050001c 00040000 c0000000 08000000 90000040 00404100 00060003 a0040000 00000600 |