On Target CLTR1_HUMAN 0.18831168/CHEMBL416769
For the given ligand a, we have found in our database that, being scored 0.18831168, the most similar ligand is CHEMBL416769. Check out the elaboration below.
| a (Given Ligand) | CHEMBL416769 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | OC(=O)c1cc(Cl)cc2C(=O)C=C(Oc12)c3cccc(\C=C\c4ccc5ccccc5n4)c3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0040a002 10200800 00084100 10050e00 00040221 82004120 84010080 48800608 02004100 40000840 00080115 40008c00 42008c15 007000c8 80020062 420c020c 00064400 02001800 06200200 00000000 40240000 18128b28 30884001 80590004 08002000 82004005 04412074 48900241 00406004 01a60800 c4040040 00020000 |