On Target DRD3_HUMAN 0.28125/CHEMBL374749
For the given ligand a, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL374749. Check out the elaboration below.
| a (Given Ligand) | CHEMBL374749 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1ccccc1N2CCN(CCCCNC(=O)c3ccc(cc3)c4ccccc4)CC2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000e002 00001800 00100120 44010600 00000000 00000000 00000000 2a001000 00200100 00000ac0 00200004 40028800 82008806 00002000 00000440 00000000 00060000 12000000 0c000000 10000201 40100000 38068700 30000021 0241001e 00002000 c0000400 00000000 900000c0 0800c100 00060001 a0040000 00020200 |