On Target ADA2C_HUMAN 0.3548387/CHEMBL420
For the given ligand a, we have found in our database that, being scored 0.3548387, the most similar ligand is CHEMBL420. Check out the elaboration below.
| a (Given Ligand) | CHEMBL420 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | NC(=N)N\N=C\c1c(Cl)cccc1Cl |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008008 00000000 00000100 00012a00 0000a000 00000020 00000000 81084000 00000100 00000843 00000000 40008800 82000004 00000400 00000000 00080000 00000000 02800000 00000400 00000000 00080000 08000100 40040000 00400000 00002000 80000a00 40000100 00000000 00000028 000e0000 40100800 00020000 |