On Target GRM1_HUMAN 0.22222222/CHEMBL1269125
For the given ligand a, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL1269125. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1269125 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | NCCCNCCCCNCCCNC(=O)[C@H](CC1CCCCC1)NC(=O)c2ccc(cc2)c3ccccc3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0001a000 01003c00 00100100 44010600 00000000 00000000 00000000 22001008 00200100 000109e0 00200000 4003b000 8600880a 00002000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 380e8610 10000001 0250001c 00000000 c0000000 00000000 90000040 08004100 00060011 a0064000 00002200 |