On Target AGTR2_HUMAN 0.19166666/CHEMBL290286
For the given ligand a, we have found in our database that, being scored 0.19166666, the most similar ligand is CHEMBL290286. Check out the elaboration below.
| a (Given Ligand) | CHEMBL290286 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | OC(=O)[C@@H]1Cc2cc(ccc2CN1C(=O)C(c3ccccc3)c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a008 00805000 00100100 10010600 000010a1 00000000 01001000 03001004 00000980 00080840 08300000 4000b000 87008882 00200000 c0080480 00080008 10020200 02001020 04400008 10000201 80020100 18208e00 13004040 81400018 00000800 e0000081 00004000 c0000041 04004180 00860003 20046000 00002600 |