On Target NPY5R_HUMAN 0.30107528/CHEMBL332561
For the given ligand a, we have found in our database that, being scored 0.30107528, the most similar ligand is CHEMBL332561. Check out the elaboration below.
| a (Given Ligand) | CHEMBL332561 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1ccc(cc1Cl)c2c[nH]c(n2)c3cnccn3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008202 00010000 00000100 11010210 00000040 00000008 04008000 00080040 10000100 00000850 00008000 40008810 02000004 00180000 80820000 800c0004 08020000 12003000 04000000 50406000 01000000 68008900 21002000 00400000 00042003 80180000 08040200 00001044 0001400c 00620800 40000820 13020000 |