On Target AA2AR_HUMAN 0.34848484/CHEMBL496
For the given ligand a, we have found in our database that, being scored 0.34848484, the most similar ligand is CHEMBL496. Check out the elaboration below.
| a (Given Ligand) | CHEMBL496 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 |