On Target DRD4_HUMAN 0.32142857/CHEMBL366043
For the given ligand a, we have found in our database that, being scored 0.32142857, the most similar ligand is CHEMBL366043. Check out the elaboration below.
| a (Given Ligand) | CHEMBL366043 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1ccc(cc1)c2ccc(cc2)C(=O)NC3CCN(Cc4ccccc4)C3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 00003c00 00100100 44010600 00000000 00000010 00000000 22001008 00000100 000109e0 00200000 40008800 82008806 00002000 00000400 00000000 00020000 02000000 04000000 10000201 00000000 380a8700 10000000 0240001c 00002000 c0000000 00040000 90000040 08004100 00060011 a0040000 01020200 |