On Target TSHR_HUMAN 0.1826087/CHEMBL4114422
For the given ligand a, we have found in our database that, being scored 0.1826087, the most similar ligand is CHEMBL4114422. Check out the elaboration below.
| a (Given Ligand) | CHEMBL4114422 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CC(=O)N1c2ccc(NC(=O)CCc3cccc(Cl)c3)cc2[C@](C)(CC1(C)C)c4ccccc4 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0800c002 05001200 40100102 00010600 24000020 00082040 05000000 21000000 00400800 000808d0 08380024 40009800 06008006 00300800 80020040 00040000 00048000 02000001 08000008 00000201 44100100 18040700 20002000 00440018 00042800 a1000000 00000010 50001080 00488080 0006000b 00000080 20020600 |