On Target NPFF1_HUMAN 0.2972973/CHEMBL575058
For the given ligand a, we have found in our database that, being scored 0.2972973, the most similar ligand is CHEMBL575058. Check out the elaboration below.
| a (Given Ligand) | CHEMBL575058 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | NC(=N)N\N=C(/c1ccccc1)\c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008008 04000000 00000100 00010a00 00002000 00000000 04000000 81084000 00000100 000c0847 08000000 40008800 82000024 00000000 80000000 00080000 04000000 02000000 00000400 00000000 00080000 08000100 40040000 00400010 00002000 a0100800 40040100 40000000 000000a8 000e0402 40100800 00020400 |