On Target NPY1R_HUMAN 0.1826923/CHEMBL551876
For the given ligand a, we have found in our database that, being scored 0.1826923, the most similar ligand is CHEMBL551876. Check out the elaboration below.
| a (Given Ligand) | CHEMBL551876 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | C[C@@H](N[C@@H]1CC[C@@H](C(=O)N2CCC(CC2)(C(=O)N3CCCC3)c4ccccc4)C(C)(C)C1)c5ccc(Cl)cc5 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00038000 01001200 00100100 00010600 00000000 00000010 00000000 22001000 00200880 000808c0 08300000 50039800 0700887e 00000000 40000400 00040000 00000000 02000000 02002000 00000201 00000100 18248730 00000000 81500018 00002000 c0000000 00040000 90000000 04000100 0006000b 20062000 00822600 |