On Target GRM2_HUMAN 0.35632184/CHEMBL503697
For the given ligand a, we have found in our database that, being scored 0.35632184, the most similar ligand is CHEMBL503697. Check out the elaboration below.
| a (Given Ligand) | CHEMBL503697 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | C[C@@H]1CN(Cc2ccc(cc2)c3cccc(Cl)c3)C(=O)O1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a008 00c05800 00100300 80810600 00000080 00008000 04000000 02001000 00000300 00000840 00200000 40008800 82008806 00000000 80001400 001a0008 10060000 02000000 04000800 10002200 80000000 18008d10 12000000 0040001c 00002000 c0000002 10000000 80200041 00004300 00060001 a0040000 00020200 |