On Target OPRD_HUMAN 0.26495728/CHEMBL250186
For the given ligand a, we have found in our database that, being scored 0.26495728, the most similar ligand is CHEMBL250186. Check out the elaboration below.
| a (Given Ligand) | CHEMBL250186 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | C[C@H]1C2Cc3ccc(cc3[C@@]1(C)CCN2CC4CC4)C(=O)NCCc5ccc(cc5)c6ccc(Cl)c(Cl)c6 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a000 01001a00 00100102 40810600 00000021 00000002 14000000 22001005 00000980 00080ac0 08300000 50818800 82008806 01200000 80000420 0a0c0008 00020200 02000000 04002400 10002201 00000100 18228710 11004000 8150001c 00002000 c0100001 08040000 90000040 04004102 0006000b a0060000 01022600 |