On Target CXCR4_HUMAN 0.21875/CHEMBL2311089
For the given ligand a, we have found in our database that, being scored 0.21875, the most similar ligand is CHEMBL2311089. Check out the elaboration below.
| a (Given Ligand) | CHEMBL2311089 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | O.O.Cl.Cl.Cl.Cl.Cl.Cl.Cl.Cl.C(N1CCCNCCNCCCNCC1)c2ccc(CN3CCCNCCNCCCNCC3)cc2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00000000 00000400 00100100 04010600 00000000 00000000 00000000 02001000 00000100 00010960 00200000 40008000 80000802 00002000 00000400 00000000 00000000 02000000 00000000 00000200 00000000 38008000 00000001 02400010 00000000 c0000000 00000000 80000000 08000100 00060010 20040000 00020200 |