On Target CCKAR_HUMAN 0.1875/CHEMBL206025
For the given ligand a, we have found in our database that, being scored 0.1875, the most similar ligand is CHEMBL206025. Check out the elaboration below.
| a (Given Ligand) | CHEMBL206025 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CCCCCN(CCCOC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00038000 09003800 00100100 04010600 00180000 00000000 04000000 22001008 00000000 000b08c8 00200000 4001b800 06008876 01002000 80000400 00080008 00200000 02000000 00c00000 00000201 00000000 38168f00 01000081 0250001c 00002001 c0100000 00040000 90000000 08000300 00060801 a0044000 00822a00 |