On Target ACM2_HUMAN 0.2837838/CHEMBL1290183
For the given ligand a, we have found in our database that, being scored 0.2837838, the most similar ligand is CHEMBL1290183. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1290183 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1cccc(CN2CCC3(CC2)CCN(CC3)C(=O)c4ccccc4)c1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 09001800 00100100 00010600 00000000 00000000 04000000 22001000 00000000 000008c8 00200000 50018800 02008806 00000000 80000400 00000000 00000000 02000000 00000000 00000201 00000000 18068720 00000000 0050001c 00002000 c0000000 00000000 90000000 00000100 00060001 a0040000 00020200 |